CymitQuimica logo

CAS 133218-07-2

:

5-(2-Propyn-1-yl)-1,3-benzodioxole

Description:
5-(2-Propyn-1-yl)-1,3-benzodioxole, identified by its CAS number 133218-07-2, is an organic compound characterized by its unique structural features, which include a benzodioxole core and a propynyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the dioxole ring suggests that it may participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic attacks, due to the electron-rich nature of the benzodioxole moiety. Additionally, the propynyl group introduces a triple bond, which can engage in further reactions such as addition or polymerization. The compound's solubility and behavior in different solvents can vary, influenced by its functional groups and overall molecular structure. While specific physical properties such as melting point, boiling point, and solubility are not detailed here, compounds of this type are often studied for their potential applications in pharmaceuticals, agrochemicals, and materials science due to their interesting chemical reactivity and structural diversity.
Formula:C10H8O2
InChI:InChI=1S/C10H8O2/c1-2-3-8-4-5-9-10(6-8)12-7-11-9/h1,4-6H,3,7H2
InChI key:InChIKey=VNQOHNBBMYOOHQ-UHFFFAOYSA-N
SMILES:C(C#C)C=1C=C2C(=CC1)OCO2
Synonyms:
  • 1,3-Benzodioxole, 5-(2-propyn-1-yl)-
  • 1,3-Benzodioxole, 5-(2-propynyl)-
  • 5-(2-Propyn-1-yl)-1,3-benzodioxole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.