CAS 13323-48-3
:2-Butenoic acid, 2-methyl-, (1aR,3R,3aR,6aR,7E,9S,10aR)-1a,2,3,3a,4,5,6a,9,10,10a-decahydro-9-hydroxy-1a,8-dimethyl-4-methylene-5-oxooxireno[5,6]cyclodeca[1,2-b]furan-3-yl ester, (2E)-
Description:
2-Butenoic acid, 2-methyl-, with the specified stereochemistry and complex structure, is a chemical compound characterized by its unique molecular framework that includes a decahydro-oxireno-cyclodeca-furan moiety. This compound features multiple functional groups, including a carboxylic acid and an ester, which contribute to its reactivity and potential applications in organic synthesis. The presence of stereocenters indicates that it can exist in different stereoisomeric forms, which may exhibit distinct physical and chemical properties. Typically, compounds of this nature may be involved in biological processes or serve as intermediates in the synthesis of more complex molecules. The molecular structure suggests potential for interactions with biological systems, possibly influencing its solubility, stability, and reactivity. Additionally, the compound's CAS number, 13323-48-3, allows for easy identification in chemical databases, facilitating research and application in various fields, including medicinal chemistry and materials science. Overall, the characteristics of this compound highlight its complexity and potential utility in chemical research and applications.
Formula:C20H26O6
InChI:InChI=1/C20H26O6/c1-6-10(2)18(22)25-15-9-20(5)16(26-20)8-13(21)11(3)7-14-17(15)12(4)19(23)24-14/h6-7,13-17,21H,4,8-9H2,1-3,5H3/b10-6-,11-7-/t13-,14+,15+,16+,17-,20+/m0/s1
InChI key:InChIKey=DZTWAOVNNLDWNH-XYXZLXRDSA-N
SMILES:O(C(/C(=C/C)/C)=O)[C@H]1[C@@]2([C@](OC(=O)C2=C)(/C=C(\C)/[C@@H](O)C[C@@]3([C@@](C)(C1)O3)[H])[H])[H]
Synonyms:- 2-Butenoic acid, 2-methyl-, (1aR,3S,4E,5aR,8aR,9R,10aR)-1a,2,3,5a,7,8,8a,9,10,10a-decahydro-3-hydroxy-4,10a-dimethyl-8-methylene-7-oxooxireno[5,6]cyclodeca[1,2-b]furan-9-yl ester, (2E)-
- Heliangin
- 2-Butenoic acid, 2-methyl-, 1a,2,3,5a,7,8,8a,9,10,10a-decahydro-3-hydroxy-4,10a-dimethyl-8-methylene-7-oxooxireno[5,6]cyclodeca[1,2-b]furan-9-yl ester, [1aR-[1aR*,3S*,4E,5aR*,8aR*,9R*(E),10aR*]]-
- 2-Butenoic acid, 2-methyl-, (1aR,3R,3aR,6aR,7E,9S,10aR)-1a,2,3,3a,4,5,6a,9,10,10a-decahydro-9-hydroxy-1a,8-dimethyl-4-methylene-5-oxooxireno[5,6]cyclodeca[1,2-b]furan-3-yl ester, (2E)-
- Germacra-4,11(13)-dien-12-oic acid, 1β,10-epoxy-3β,6α,8β-trihydroxy-, 12,6-lactone, 8-(2-methylcrotonate), (E,E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(E)-2-Methyl-2-butenoic acid [(1aR,3S,4Z,5aR,8aR,9R,10aR)-1a,2,3,5a,7,8,8a,9,10,10a-decahydro-3-hydroxy-4,10a-dimethyl-8-methylene-7-oxooxireno[5,6]cyclodeca[1,2-b]furan-9-yl] ester
CAS:Formula:C20H26O6Purity:98.0%Color and Shape:SolidMolecular weight:362.4168Heliangin
CAS:Heliangin has anti-inflammatory and anti-cancer properties, inhibiting LPS-induced inflammation and cytotoxic to KB, Hela, and hepa59T/VGH cells.Formula:C20H26O6Purity:98%Color and Shape:SolidMolecular weight:362.422Heliangin
CAS:Heliangin is a sesquiterpene lactone, which is a type of natural compound derived from plants, specifically sourced from the genus Helianthus. Its mode of action involves interfering with plant metabolic processes, possibly through the inhibition of key enzymes or disruption of cellular structures. This action leads to reduced growth and vitality in competing plant species.
Formula:C20H26O6Purity:Min. 95%Molecular weight:362.4 g/mol


