CAS 13323-62-1

1,1′-(Dibutylstannylene) di-(9Z)-9-octadecenoate

Description:

1,1′-(Dibutylstannylene) di-(9Z)-9-octadecenoate, with the CAS number 13323-62-1, is an organotin compound characterized by the presence of a dibutylstannylene moiety and two octadecenoate ester groups. This compound typically exhibits a high molecular weight and is known for its unique structural features, including the presence of a tin atom bonded to two butyl groups and two long-chain fatty acid derivatives. The octadecenoate groups contribute to its hydrophobic nature and potential applications in various fields, including materials science and organic synthesis. Organotin compounds often display interesting chemical reactivity, including the ability to act as catalysts or intermediates in polymerization processes. Additionally, the presence of unsaturation in the octadecenoate chains may impart specific properties such as flexibility and reactivity towards other chemical species. However, it is important to note that organotin compounds can pose environmental and health risks, necessitating careful handling and regulation.

Formula: C₄₄H₈₄O₄Sn

InChI: InChI=1S/2C18H34O2.2C4H9.Sn/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2*1-3-4-2;/h2*9-10H,2-8,11-17H2,1H3,(H,19,20);2*1,3-4H2,2H3;/q;;;;+2/p-2/b2*10-9-;;;

InChI key: InChIKey=AWFFJJAOMMAGFE-BGSQTJHASA-L

SMILES: [Sn](OC(CCCCCCC/C=C\CCCCCCCC)=O)(OC(CCCCCCC/C=C\CCCCCCCC)=O)(CCCC)CCCC

Synonyms:

• Stannane, dibutylbis(oleoyloxy)-
• Stannane, dibutylbis[(1-oxo-9-octadecenyl)oxy]-, (Z,Z)-
• Tin, dibutylbis(oleoyloxy)-
• Dibutyltin dioleate
• 9-Octadecenoic acid (9Z)-, 1,1′-(dibutylstannylene) ester

9-Octadecenoic acid (9Z)-, 1,1'-(dibutylstannylene) ester

CAS: 13323-62-1

Formula: C₄₄H₈₄O₄Sn

Molecular weight: 795.8364

Ref: IN-DA0014FF