CymitQuimica logo

CAS 1332300-71-6

:

3-Amino-2-fluoro-N-methylbenzamide

Description:
3-Amino-2-fluoro-N-methylbenzamide is an organic compound characterized by the presence of an amino group, a fluorine atom, and a methyl group attached to a benzamide structure. The compound features a benzene ring substituted with an amino group at the meta position relative to the carbonyl group of the amide, and a fluorine atom at the ortho position. This specific arrangement influences its chemical reactivity and physical properties, such as solubility and boiling point. The presence of the fluorine atom can enhance the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry. The methyl group contributes to the steric and electronic properties of the molecule, potentially influencing its interactions with biological targets. As with many amides, 3-Amino-2-fluoro-N-methylbenzamide may exhibit hydrogen bonding capabilities, which can affect its stability and reactivity in various chemical environments. Overall, this compound's unique structure positions it as a candidate for further research in pharmaceutical applications and chemical synthesis.
Formula:C8H9FN2O
InChI:InChI=1S/C8H9FN2O/c1-11-8(12)5-3-2-4-6(10)7(5)9/h2-4H,10H2,1H3,(H,11,12)
InChI key:InChIKey=UJMHVWIFIXJUBX-UHFFFAOYSA-N
SMILES:C(NC)(=O)C1=C(F)C(N)=CC=C1
Synonyms:
  • Benzamide, 3-amino-2-fluoro-N-methyl-
  • 3-Amino-2-fluoro-N-methylbenzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.