CAS 133232-56-1: 3-Iodo-2-methylbenzoic acid

Description:3-Iodo-2-methylbenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with both an iodine atom and a methyl group. The iodine atom is located at the meta position relative to the carboxylic acid group, while the methyl group is positioned at the ortho position. This compound typically appears as a solid and is known for its potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the iodine atom can enhance the compound's reactivity and influence its biological activity. Additionally, the carboxylic acid functional group contributes to its acidity and solubility properties, making it more polar compared to other hydrocarbons. The compound's molecular structure allows for various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks.

Formula:C₈H₆IO₂

InChI:InChI=1/C8H7IO2/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4H,1H3,(H,10,11)/p-1

Synonyms:
2-Methyl-3-Iodobenzoic Acid
3-Iodo-2-Methylbenzoate

Found 4 products.

Product data	Purity	Price range	Estimated delivery
3-Iodo-2-methylbenzoic acid REF: 10-F018744CAS: 133232-56-1	98.0%	24.00 €~168.00 €	Tue 01 Apr 25
Benzoic acid, 3-iodo-2-methyl- REF: IN-DA0014G2CAS: 133232-56-1	96%	To inquire	Mon 07 Apr 25
3-Iodo-2-methylbenzoic acid REF: 54-OR13733CAS: 133232-56-1	By hplc: 99.0% by area (210nm) (Typical Value in Batch COA)	32.00 €~177.00 €	Tue 08 Apr 25
3-Iodo-2-methylbenzoic acid REF: 3D-FI55333CAS: 133232-56-1	Min. 95%	190.00 €~1,189.00 €	Mon 02 Jun 25