CAS 133232-56-1
:3-Iodo-2-methylbenzoic acid
Description:
3-Iodo-2-methylbenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with both an iodine atom and a methyl group. The iodine atom is located at the meta position relative to the carboxylic acid group, while the methyl group is positioned at the ortho position. This compound typically appears as a solid and is known for its potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the iodine atom can enhance the compound's reactivity and influence its biological activity. Additionally, the carboxylic acid functional group contributes to its acidity and solubility properties, making it more polar compared to other hydrocarbons. The compound's molecular structure allows for various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks.
Formula:C8H6IO2
InChI:InChI=1/C8H7IO2/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4H,1H3,(H,10,11)/p-1
SMILES:Cc1c(cccc1I)C(=O)[O-]
Synonyms:- 2-Methyl-3-Iodobenzoic Acid
- 3-Iodo-2-Methylbenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid, 3-iodo-2-methyl-
CAS:Formula:C8H7IO2Purity:97%Color and Shape:SolidMolecular weight:262.04443-Iodo-2-methylbenzoic acid
CAS:3-Iodo-2-methylbenzoic acidFormula:C8H7IO2Purity:≥95%Color and Shape: off white to faint lemon crystalline powderMolecular weight:262.04445g/mol3-Iodo-2-methylbenzoic acid
CAS:Formula:C8H7IO2Purity:97%Color and Shape:SolidMolecular weight:262.0463-Iodo-2-methylbenzoic acid
CAS:3-Iodo-2-methylbenzoic acid is a reagent that is used as an intermediate in the synthesis of complex compounds and fine chemicals. 3-Iodobenzoic acid is classified as a speciality chemical, which means it can be used for research purposes only. 3-Iodo-2-methylbenzoic acid has many uses, including being a versatile building block in chemical reactions and a reaction component in the synthesis of useful scaffolds and building blocks.Formula:C8H7IO2Purity:Min. 95%Color and Shape:SolidMolecular weight:262.04 g/mol



