CymitQuimica logo

CAS 1332324-23-8

:

5-Bromo-2-methoxy-4-methyl-3-pyridinecarboxaldehyde

Description:
5-Bromo-2-methoxy-4-methyl-3-pyridinecarboxaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 5-position, a methoxy group (-OCH3) at the 2-position, and a methyl group (-CH3) at the 4-position contributes to its unique chemical properties and reactivity. The aldehyde functional group (-CHO) at the 3-position is significant for its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic addition and condensation reactions. This compound may exhibit polar characteristics due to the presence of the aldehyde and methoxy groups, influencing its solubility in different solvents. Additionally, the bromine substituent can enhance its reactivity in electrophilic aromatic substitution reactions. Overall, 5-Bromo-2-methoxy-4-methyl-3-pyridinecarboxaldehyde is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals due to its structural features.
Formula:C8H8BrNO2
InChI:InChI=1S/C8H8BrNO2/c1-5-6(4-11)8(12-2)10-3-7(5)9/h3-4H,1-2H3
InChI key:InChIKey=IIDGUFCJFPWYPU-UHFFFAOYSA-N
SMILES:C(=O)C1=C(OC)N=CC(Br)=C1C
Synonyms:
  • 5-Bromo-2-methoxy-4-methyl-3-pyridinecarboxaldehyde
  • 3-Pyridinecarboxaldehyde, 5-bromo-2-methoxy-4-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.