CAS 1332356-31-6
:3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]benzenamine
Description:
3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]benzenamine is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with two fluorine atoms and an amine group, as well as a piperidine moiety linked to another phenyl group. The presence of fluorine atoms typically enhances the compound's lipophilicity and metabolic stability, making it of interest in pharmaceutical applications. The piperidine ring contributes to the compound's potential biological activity, often influencing receptor binding and activity in medicinal chemistry. This compound may exhibit properties such as increased potency or selectivity for certain biological targets, which is valuable in drug development. Its molecular structure suggests potential applications in areas such as neuropharmacology or oncology, where modulation of specific pathways is desired. As with many fluorinated compounds, it may also possess unique physical and chemical properties, including altered solubility and reactivity compared to its non-fluorinated counterparts. Safety and handling considerations are essential, as with all chemical substances, particularly those with potential biological activity.
Formula:C17H17F3N2
InChI:InChI=1S/C17H17F3N2/c18-13-3-1-11(2-4-13)12-5-7-22(8-6-12)17-15(19)9-14(21)10-16(17)20/h1-4,9-10,12H,5-8,21H2
InChI key:InChIKey=IQFWNVBJEZXPAF-UHFFFAOYSA-N
SMILES:FC1=C(C(F)=CC(N)=C1)N2CCC(CC2)C3=CC=C(F)C=C3
Synonyms:- 3,5-Difluoro-4-[4-(4-fluorophenyl)piperidin-1-yl]aniline
- 3,5-Difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]benzenamine
- Benzenamine, 3,5-difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3,5-difluoro-4-(4-(4-fluorophenyl)piperidin-1-yl)aniline
CAS:Controlled ProductFormula:C17H17F3N2Color and Shape:NeatMolecular weight:306.325

