CAS 1332370-00-9
:(2E)-3-[4-(Hydroxymethyl)phenyl]-2-propenoic acid
Description:
(2E)-3-[4-(Hydroxymethyl)phenyl]-2-propenoic acid, also known as a derivative of cinnamic acid, is characterized by its unique structural features, including a propenoic acid backbone and a hydroxymethyl-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. The presence of the hydroxymethyl group enhances its solubility in polar solvents and may influence its interaction with biological targets. As a conjugated system, it may display interesting optical properties, including potential UV absorption. The compound's acidity is attributed to the carboxylic acid functional group, which can participate in hydrogen bonding and affect its overall reactivity. Additionally, it may exhibit antioxidant properties, making it of interest in various fields, including pharmaceuticals and materials science. Its specific applications and behavior in chemical reactions would depend on the context of use and the presence of other functional groups in a given formulation.
Formula:C10H10O3
InChI:InChI=1S/C10H10O3/c11-7-9-3-1-8(2-4-9)5-6-10(12)13/h1-6,11H,7H2,(H,12,13)/b6-5+
InChI key:InChIKey=WBVWJXSDIOLYPW-AATRIKPKSA-N
SMILES:C(=C/C(O)=O)\C1=CC=C(CO)C=C1
Synonyms:- 2-Propenoic acid, 3-[4-(hydroxymethyl)phenyl]-, (2E)-
- (2E)-3-[4-(Hydroxymethyl)phenyl]-2-propenoic acid
- 3-[4-(hydroxymethyl)phenyl]prop-2-enoic acid
- (E)-3-(4-(hydroxymethyl)phenyl)acrylic acid
- Ozagrel Impurity 39
- Ozagrel-015-E
- Ozagrel-015
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ozagrel Impurity 15
CAS:Formula:C10H10O3Color and Shape:White To Off-White SolidMolecular weight:178.19

