CAS 1332370-62-3

4-Amino-1-methyl-1H-pyrazolo[3,4-b]pyridine-5-carboxylic acid

Description:

4-Amino-1-methyl-1H-pyrazolo[3,4-b]pyridine-5-carboxylic acid is a heterocyclic organic compound characterized by its pyrazolo-pyridine structure, which incorporates both a pyrazole and a pyridine ring. This compound features an amino group and a carboxylic acid functional group, contributing to its potential as a bioactive molecule. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its unique arrangement of nitrogen atoms within the rings may influence its reactivity and interaction with biological targets. Additionally, the presence of the methyl group can affect its lipophilicity and overall pharmacokinetic properties. As with many heterocycles, the compound may also exhibit interesting electronic properties, making it a subject of interest in materials science and organic electronics.

Formula: C₈H₈N₄O₂

InChI: InChI=1S/C8H8N4O2/c1-12-7-4(3-11-12)6(9)5(2-10-7)8(13)14/h2-3H,1H3,(H2,9,10)(H,13,14)

InChI key: InChIKey=ROSIGSWGXSQRNV-UHFFFAOYSA-N

SMILES: NC1=C2C(=NC=C1C(O)=O)N(C)N=C2

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-5-carboxylic acid, 4-amino-1-methyl-
• 4-Amino-1-methyl-1H-pyrazolo[3,4-b]pyridine-5-carboxylic acid

4-Imino-1-methyl-1H,4H,7H-pyrazolo[3,4-b]pyridine-5-carboxylic acid

CAS: 1332370-62-3

Versatile small molecule scaffold

Formula: C₈H₈N₄O₂

Purity: Min. 95%

Molecular weight: 192.17 g/mol

Ref: 3D-HDC37062