CAS 133238-87-6
:2-Butyl-5-nitrobenzofuran
Description:
2-Butyl-5-nitrobenzofuran is an organic compound characterized by its unique structure, which includes a benzofuran moiety substituted with a butyl group and a nitro group. This compound typically exhibits a yellow to orange color due to the presence of the nitro group, which can also influence its reactivity and solubility. The butyl group contributes to its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. The nitro group is known for its electron-withdrawing properties, which can affect the compound's reactivity in various chemical reactions, including electrophilic aromatic substitution. Additionally, the presence of the benzofuran ring suggests potential biological activity, as many benzofuran derivatives are studied for their pharmacological properties. Safety data and handling precautions should be considered, as nitro compounds can be hazardous. Overall, 2-Butyl-5-nitrobenzofuran is of interest in both synthetic organic chemistry and potential applications in pharmaceuticals or materials science.
Formula:C12H13NO3
InChI:InChI=1S/C12H13NO3/c1-2-3-4-11-8-9-7-10(13(14)15)5-6-12(9)16-11/h5-8H,2-4H2,1H3
InChI key:InChIKey=XGAJABPTUOLUAE-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C2C(OC(CCCC)=C2)=CC1
Synonyms:- 2-Butyl-5-nitro-1-benzofuran
- 2-Butyl-5-nitro-benzofuran
- 2-N-Butyl 5-Nitrobenzofuran
- 5-Nitro-2-Butyl Benzofuran
- Benzofuran, 2-Butyl-5-Nitro-
- 2-Butyl-5-nitrobenzofuran
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzofuran, 2-butyl-5-nitro-
CAS:Formula:C12H13NO3Purity:98%Color and Shape:SolidMolecular weight:219.23652-Butyl-5-nitrobenzofuran
CAS:Controlled ProductApplications Dronedarone intermediate.
Formula:C12H13NO3Color and Shape:NeatMolecular weight:219.242-Butyl-5-nitrobenzofuran
CAS:2-Butyl-5-nitrobenzofuran (2B5NBF) is a drug that belongs to the class of salicylaldehydes. It is an acylation product of 2-butanol and 5-nitrobenzofuran that has the potential for use as a pharmaceutical agent. The reaction yield for this compound is high and can be increased by using hydrochloric acid as the acid catalyst. When 2B5NBF is reacted with chloride, it produces an active substance with a structural formula of C14H11NO3Cl. This substance has been shown to have arrhythmic properties in atrial tissue in rats.Formula:C12H13NO3Purity:Min. 95%Molecular weight:219.24 g/mol





