CAS 13324-13-5
:ethyl 4-methoxy-2-nitrobenzoate
Description:
Ethyl 4-methoxy-2-nitrobenzoate, with the CAS number 13324-13-5, is an organic compound characterized by its ester functional group, which is derived from benzoic acid. This compound features a nitro group (-NO2) and a methoxy group (-OCH3) attached to the benzene ring, contributing to its chemical reactivity and properties. It typically appears as a yellow to orange solid or liquid, depending on its purity and specific conditions. Ethyl 4-methoxy-2-nitrobenzoate is known for its applications in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. Its molecular structure allows for potential electrophilic substitution reactions, making it a valuable intermediate in synthetic chemistry. Additionally, the presence of both electron-withdrawing (nitro) and electron-donating (methoxy) groups influences its reactivity and solubility in different solvents. Safety data should be consulted for handling, as nitro compounds can be sensitive and may pose health risks.
Formula:C10H11NO5
InChI:InChI=1/C10H11NO5/c1-3-16-10(12)8-5-4-7(15-2)6-9(8)11(13)14/h4-6H,3H2,1-2H3
SMILES:CCOC(=O)c1ccc(cc1N(=O)=O)OC
Synonyms:- Benzoic Acid, 4-Methoxy-2-Nitro-, Ethyl Ester
- Ethyl-4-methoxy-2-nitrobenzolcarboxylat
- Ethyl 4-methoxy-2-nitrobenzoate
- 4-METHOXY-2-NITROBENZOIC ACID ETHYL ESTER
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
