CAS 13324-23-7

1,5-Bis(dimethylamino)-4,8-dihydroxy-9,10-anthracenedione

Description:

1,5-Bis(dimethylamino)-4,8-dihydroxy-9,10-anthracenedione, with CAS number 13324-23-7, is a synthetic organic compound belonging to the anthraquinone class. This substance is characterized by its two dimethylamino groups and two hydroxyl groups attached to the anthracene backbone, which contribute to its unique chemical properties. It typically exhibits a deep color, often appearing as a dark solid or powder, and is soluble in various organic solvents. The presence of the dimethylamino groups enhances its electron-donating ability, making it a potential candidate for applications in dyes, pigments, and as a fluorescent probe. Additionally, the hydroxyl groups can participate in hydrogen bonding, influencing its solubility and reactivity. This compound may also exhibit biological activity, which warrants further investigation for potential pharmaceutical applications. Overall, its structural features and functional groups make it an interesting subject for research in both organic chemistry and materials science.

Formula: C₁₈H₁₈N₂O₄

InChI: InChI=1S/C18H18N2O4/c1-19(2)9-5-7-11(21)15-13(9)17(23)16-12(22)8-6-10(20(3)4)14(16)18(15)24/h5-8,21-22H,1-4H3

InChI key: InChIKey=QWNYSSXILSEIKT-UHFFFAOYSA-N

SMILES: O=C1C=2C(C(=O)C=3C1=C(O)C=CC3N(C)C)=C(O)C=CC2N(C)C

Synonyms:

• Anthraquinone, 1,5-bis(dimethylamino)-4,8-dihydroxy-
• 9,10-Anthracenedione, 1,5-bis(dimethylamino)-4,8-dihydroxy-
• 1,5-Bis(dimethylamino)-4,8-dihydroxy-9,10-anthracenedione

9,10-Anthracenedione, 1,5-bis(dimethylamino)-4,8-dihydroxy-

CAS: 13324-23-7

Formula: C₁₈H₁₈N₂O₄

Molecular weight: 326.3465

Ref: IN-DA0014G9