CAS 133240-38-7
:7-methyl-2-propyl-3-{[2'-(2H-tetrazol-5-yl)biphenyl-4-yl]methyl}-3H-imidazo[4,5-b]pyridine
Description:
7-Methyl-2-propyl-3-{[2'-(2H-tetrazol-5-yl)biphenyl-4-yl]methyl}-3H-imidazo[4,5-b]pyridine, with CAS number 133240-38-7, is a chemical compound characterized by its complex structure, which includes an imidazopyridine core and a biphenyl moiety substituted with a tetrazole group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the tetrazole group may enhance its pharmacological profile, possibly influencing its solubility, stability, and interaction with biological targets. The compound's molecular structure suggests it may participate in various chemical reactions, including those typical of nitrogen-containing heterocycles. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the precise arrangement of its functional groups and the overall molecular conformation. As with many complex organic compounds, further studies would be necessary to fully elucidate its properties and potential applications in drug development or other fields.
Formula:C24H23N7
InChI:InChI=1/C24H23N7/c1-3-6-21-26-22-16(2)13-14-25-24(22)31(21)15-17-9-11-18(12-10-17)19-7-4-5-8-20(19)23-27-29-30-28-23/h4-5,7-14H,3,6,15H2,1-2H3,(H,27,28,29,30)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3H-Imidazo[4,5-b]pyridine, 7-methyl-2-propyl-3-[[2'-(2H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methyl]-
CAS:Formula:C24H23N7Molecular weight:409.4863L 158338
CAS:<p>L 158338 is an antagonist of the angiotensin receptor.</p>Formula:C24H23N7Color and Shape:SolidMolecular weight:409.49

