CAS 1332455-35-2

Cyclopropyl-4-piperidinylmethanone

Description:

Cyclopropyl-4-piperidinylmethanone is a chemical compound characterized by its unique structural features, which include a cyclopropyl group and a piperidine ring. The presence of the cyclopropyl moiety contributes to its rigidity and may influence its reactivity and interaction with biological targets. The piperidine ring, a six-membered nitrogen-containing heterocycle, is known for its presence in various pharmacologically active compounds, often contributing to their ability to interact with neurotransmitter systems. This compound may exhibit properties such as lipophilicity, which can affect its solubility and permeability in biological systems. Additionally, the methanone functional group introduces a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic attacks. The specific applications and biological activities of Cyclopropyl-4-piperidinylmethanone would depend on its interaction with specific receptors or enzymes, making it of interest in medicinal chemistry and drug development. As with many compounds, safety and handling considerations are essential, particularly regarding its potential toxicity and environmental impact.

Formula: C₉H₁₅NO

InChI: InChI=1S/C9H15NO/c11-9(7-1-2-7)8-3-5-10-6-4-8/h7-8,10H,1-6H2

InChI key: InChIKey=VWHLYSMNXJLMIE-UHFFFAOYSA-N

SMILES: C(=O)(C1CC1)C2CCNCC2

Synonyms:

• Methanone, cyclopropyl-4-piperidinyl-
• Cyclopropyl-4-piperidinylmethanone