CymitQuimica logo

CAS 13325-57-0

:

5-[2-(9,10-Dihydro-9,10-dioxo-1-anthracenyl)diazenyl]-2,4,6(1H,3H,5H)-pyrimidinetrione

Description:
5-[2-(9,10-Dihydro-9,10-dioxo-1-anthracenyl)diazenyl]-2,4,6(1H,3H,5H)-pyrimidinetrione, with CAS number 13325-57-0, is a synthetic organic compound characterized by its complex structure, which includes an anthracene moiety and a pyrimidinetrione framework. This compound features a diazenyl linkage, which contributes to its potential as a dye or pigment due to the extended conjugation provided by the anthracene unit. The presence of the pyrimidinetrione structure suggests potential applications in pharmaceuticals or as a biochemical probe, given the biological relevance of pyrimidine derivatives. The compound may exhibit interesting optical properties, including absorption and fluorescence characteristics, making it suitable for various applications in materials science and organic electronics. Additionally, its stability and reactivity can be influenced by the functional groups present, which may affect its solubility and interaction with other chemical species. Overall, this compound represents a unique intersection of organic chemistry and potential applications in dye chemistry and medicinal chemistry.
Formula:C18H10N4O5
InChI:InChI=1S/C18H10N4O5/c23-14-8-4-1-2-5-9(8)15(24)12-10(14)6-3-7-11(12)21-22-13-16(25)19-18(27)20-17(13)26/h1-7,13H,(H2,19,20,25,26,27)
InChI key:InChIKey=MBOXEZSDSMZDMX-UHFFFAOYSA-N
SMILES:N(=NC1C(=O)NC(=O)NC1=O)C2=C3C(C(=O)C=4C(C3=O)=CC=CC4)=CC=C2
Synonyms:
  • 5-[2-(9,10-Dihydro-9,10-dioxo-1-anthracenyl)diazenyl]-2,4,6(1H,3H,5H)-pyrimidinetrione
  • 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-[2-(9,10-dihydro-9,10-dioxo-1-anthracenyl)diazenyl]-
  • Barbituric acid, 5-(1-anthraquinonylazo)-
  • 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-[(9,10-dihydro-9,10-dioxo-1-anthracenyl)azo]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.