CymitQuimica logo

CAS 1332524-01-2

:

N-[3-Fluoro-4-[(methylamino)carbonyl]phenyl]-2-methylalanine methyl ester

Description:
N-[3-Fluoro-4-[(methylamino)carbonyl]phenyl]-2-methylalanine methyl ester is a chemical compound characterized by its complex structure, which includes a fluorinated phenyl group and a methylalanine backbone. The presence of a methylamino group suggests potential for hydrogen bonding and interactions with biological targets, making it of interest in medicinal chemistry. The methyl ester functional group indicates that the compound may exhibit lipophilic properties, potentially influencing its bioavailability and pharmacokinetics. The fluorine atom can enhance the compound's metabolic stability and alter its electronic properties, which may affect its interaction with enzymes or receptors. This compound is likely to be studied for its potential therapeutic applications, particularly in the context of drug design and development. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups. Overall, this compound exemplifies the intricate design often employed in the development of pharmaceuticals.
Formula:C13H17FN2O3
InChI:InChI=1S/C13H17FN2O3/c1-13(2,12(18)19-4)16-8-5-6-9(10(14)7-8)11(17)15-3/h5-7,16H,1-4H3,(H,15,17)
InChI key:MLHUTKWFDCMHQO-UHFFFAOYSA-N
SMILES:CC(C)(C(=O)OC)NC1=CC(=C(C=C1)C(=O)NC)F
Synonyms:
  • N-[3-fluoro-4-[(methylamino)carbonyl]phenyl]-2-methyl-Alanine methyl ester
  • N-[3-Fluoro-4-[(methylamino)carbonyl]phenyl]-2-methylalanine methyl ester(for Enzalutamide)
  • 2-(3-Fluoro-4-methylcarbamoyl-phenylamino)-2-methyl-propionic acid methyl ester
Found 8 products.