CAS 1332528-31-0

2H-Indol-2-one, 3-amino-7-chloro-1,3-dihydro-, hydrochloride (1:1)

Description:

2H-Indol-2-one, 3-amino-7-chloro-1,3-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of an amino group at the 3-position and a chlorine atom at the 7-position contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, including pharmaceuticals. This compound may exhibit properties such as antimicrobial or anticancer activity, making it of interest in medicinal chemistry. Its molecular structure allows for interactions with biological targets, which can be explored for therapeutic purposes. The compound's stability, solubility, and reactivity are influenced by the functional groups present, and it may undergo various chemical reactions typical of amines and halogenated compounds. Overall, 2H-Indol-2-one, 3-amino-7-chloro-1,3-dihydro-, hydrochloride is a significant compound in the realm of organic and medicinal chemistry.

Formula: C₈H₇ClN₂O·ClH

InChI: InChI=1S/C8H7ClN2O.ClH/c9-5-3-1-2-4-6(10)8(12)11-7(4)5;/h1-3,6H,10H2,(H,11,12);1H

InChI key: InChIKey=DHQZTWWGLTVEDY-UHFFFAOYSA-N

SMILES: NC1C=2C(=C(Cl)C=CC2)NC1=O.Cl

Synonyms:

• 2H-Indol-2-one, 3-amino-7-chloro-1,3-dihydro-, hydrochloride (1:1)