CAS 1332528-32-1

2H-Indol-2-one, 3-amino-1,3-dihydro-1-methyl-7-(trifluoromethyl)-, hydrochloride (1:1)

Description:

2H-Indol-2-one, 3-amino-1,3-dihydro-1-methyl-7-(trifluoromethyl)-, hydrochloride (1:1), with CAS number 1332528-32-1, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific derivative features a trifluoromethyl group, which enhances its lipophilicity and may influence its biological activity. The presence of an amino group contributes to its potential as a pharmacophore, making it of interest in medicinal chemistry. The hydrochloride salt form indicates that the compound is protonated, which can improve its solubility in aqueous environments, facilitating its use in biological studies or pharmaceutical applications. The compound's unique structural features suggest potential interactions with biological targets, making it a candidate for further research in drug development. Overall, its properties may be explored in various fields, including medicinal chemistry, biochemistry, and material science, depending on its specific applications and interactions.

Formula: C₁₀H₉F₃N₂O·ClH

InChI: InChI=1S/C10H9F3N2O.ClH/c1-15-8-5(7(14)9(15)16)3-2-4-6(8)10(11,12)13;/h2-4,7H,14H2,1H3;1H

InChI key: InChIKey=QIOCJGARSGFQDC-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C2C(C(N)C(=O)N2C)=CC=C1.Cl

Synonyms:

• 2H-Indol-2-one, 3-amino-1,3-dihydro-1-methyl-7-(trifluoromethyl)-, hydrochloride (1:1)