CAS 1332528-36-5

4-Quinolinecarbonyl chloride, 6-chloro-2-(2-pyridinyl)-, hydrochloride (1:1)

Description:

4-Quinolinecarbonyl chloride, 6-chloro-2-(2-pyridinyl)-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a quinoline moiety and a pyridine ring. This substance typically appears as a solid and is known for its reactivity due to the presence of the carbonyl chloride functional group, which can participate in nucleophilic substitution reactions. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its synthesis often involves multi-step organic reactions, and it may be used as an intermediate in the preparation of other chemical entities. Safety precautions are essential when handling this compound due to its potential irritant properties and reactivity. As with many chlorinated compounds, it may also pose environmental concerns, necessitating careful disposal and management practices.

Formula: C₁₅H₈Cl₂N₂O·ClH

InChI: InChI=1S/C15H8Cl2N2O.ClH/c16-9-4-5-12-10(7-9)11(15(17)20)8-14(19-12)13-3-1-2-6-18-13;/h1-8H;1H

InChI key: InChIKey=OXDHHZDEQKGJJX-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=CC=N3)C=CC(Cl)=C2.Cl

Synonyms:

• 4-Quinolinecarbonyl chloride, 6-chloro-2-(2-pyridinyl)-, hydrochloride (1:1)