CAS 1332528-43-4

1-Azaspiro[4.4]non-7-ene, hydrochloride (1:1)

Description:

1-Azaspiro[4.4]non-7-ene, hydrochloride (1:1) is a chemical compound characterized by its unique spirocyclic structure, which features a nitrogen atom incorporated into a bicyclic framework. This compound typically exhibits properties associated with both amines and cyclic compounds, including potential basicity due to the presence of the nitrogen atom. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The spiro structure may contribute to its biological activity, making it of interest in medicinal chemistry for the development of novel therapeutic agents. Additionally, the compound's stability, reactivity, and interaction with biological systems can be influenced by its specific stereochemistry and functional groups. Overall, 1-Azaspiro[4.4]non-7-ene, hydrochloride represents a class of compounds that may exhibit diverse chemical behavior and potential applications in drug discovery and development.

Formula: C₈H₁₃N·ClH

InChI: InChI=1S/C8H13N.ClH/c1-2-5-8(4-1)6-3-7-9-8;/h1-2,9H,3-7H2;1H

InChI key: InChIKey=XWTKZQXSJYMYKW-UHFFFAOYSA-N

SMILES: C12(CCCN1)CC=CC2.Cl

Synonyms:

• 1-Azaspiro[4.4]non-7-ene, hydrochloride (1:1)