CAS 1332528-44-5

2-Piperazinone, 1-[(4-chlorophenyl)methyl]-, hydrochloride (1:1)

Description:

2-Piperazinone, 1-[(4-chlorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperazinone core, which is a cyclic amide featuring a piperazine ring. The presence of a 4-chlorobenzyl group indicates that it has a chlorinated aromatic substituent, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in pharmaceutical applications. This compound may exhibit properties such as being a potential intermediate in drug synthesis or possessing pharmacological activity, although specific biological effects would depend on its interaction with biological targets. The hydrochloride form often aids in stability and handling, making it suitable for various formulations. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, 2-Piperazinone, 1-[(4-chlorophenyl)methyl]-, hydrochloride is of interest in medicinal chemistry and may serve as a lead compound for further development.

Formula: C₁₁H₁₃ClN₂O·ClH

InChI: InChI=1S/C11H13ClN2O.ClH/c12-10-3-1-9(2-4-10)8-14-6-5-13-7-11(14)15;/h1-4,13H,5-8H2;1H

InChI key: InChIKey=IWMJLZMYHKOTGM-UHFFFAOYSA-N

SMILES: C(N1C(=O)CNCC1)C2=CC=C(Cl)C=C2.Cl

Synonyms:

• 2-Piperazinone, 1-[(4-chlorophenyl)methyl]-, hydrochloride (1:1)