CAS 1332528-60-5

Ethanol, 2-[[(5-methyl-2-thiazolyl)methyl]amino]-, hydrochloride (1:2)

Description:

Ethanol, 2-[[(5-methyl-2-thiazolyl)methyl]amino]-, hydrochloride (1:2) is a chemical compound characterized by its thiazole ring structure, which contributes to its biological activity. The presence of the ethanol moiety suggests that it may exhibit solubility in polar solvents, making it suitable for various applications in pharmaceuticals and biochemistry. The hydrochloride form indicates that the compound is a salt, which often enhances its stability and solubility in aqueous solutions. This compound may possess specific pharmacological properties due to the thiazole group, which is known for its role in various biological processes. Additionally, the amino group suggests potential interactions with biological targets, such as enzymes or receptors. Overall, this compound's unique structure and functional groups may contribute to its utility in medicinal chemistry, particularly in the development of therapeutic agents. However, detailed studies would be necessary to fully elucidate its properties, mechanisms of action, and potential applications.

Formula: C₇H₁₂N₂OS·2ClH

InChI: InChI=1S/C7H12N2OS.2ClH/c1-6-4-9-7(11-6)5-8-2-3-10;;/h4,8,10H,2-3,5H2,1H3;2*1H

InChI key: InChIKey=GDHAYZLRQOXXRH-UHFFFAOYSA-N

SMILES: C(NCCO)C=1SC(C)=CN1.Cl

Synonyms:

• Ethanol, 2-[[(5-methyl-2-thiazolyl)methyl]amino]-, hydrochloride (1:2)