
CAS 1332528-73-0
:4-Pyrimidinemethanamine, 2-(1-methylethyl)-, hydrochloride (1:2)
Description:
4-Pyrimidinemethanamine, 2-(1-methylethyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a methanamine group attached to the pyrimidine, along with an isopropyl substituent, contributing to its unique properties. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the isopropyl group may influence its biological activity and interaction with biological targets. As a hydrochloride salt, it typically exhibits improved stability and bioavailability compared to its free base form. The compound's specific applications and effects would depend on its interaction with biological systems, making it of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C8H13N3·2ClH
InChI:InChI=1S/C8H13N3.2ClH/c1-6(2)8-10-4-3-7(5-9)11-8;;/h3-4,6H,5,9H2,1-2H3;2*1H
InChI key:InChIKey=IQZQYJKFZOKBMM-UHFFFAOYSA-N
SMILES:C(C)(C)C=1N=C(CN)C=CN1.Cl
Synonyms:- 4-Pyrimidinemethanamine, 2-(1-methylethyl)-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.