
CAS 1332528-96-7
:(4S)-3-[2-(3-Chlorophenyl)acetyl]-4-phenyl-2-oxazolidinone
Description:
The chemical substance known as (4S)-3-[2-(3-Chlorophenyl)acetyl]-4-phenyl-2-oxazolidinone, with the CAS number 1332528-96-7, is an oxazolidinone derivative characterized by its chiral center at the 4-position, which contributes to its stereochemistry and potential biological activity. This compound features a phenyl group and a 3-chlorophenylacetyl moiety, indicating its potential for interactions with biological targets, particularly in medicinal chemistry. Oxazolidinones are known for their antibacterial properties, and this specific compound may exhibit similar pharmacological effects. The presence of the chlorophenyl group suggests that it may have enhanced lipophilicity, which can influence its absorption and distribution in biological systems. Additionally, the oxazolidinone ring structure is significant in the context of drug design, as it can affect the compound's stability and reactivity. Overall, this substance's unique structural features may contribute to its potential applications in pharmaceuticals, particularly in the development of new therapeutic agents.
Formula:C17H14ClNO3
InChI:InChI=1S/C17H14ClNO3/c18-14-8-4-5-12(9-14)10-16(20)19-15(11-22-17(19)21)13-6-2-1-3-7-13/h1-9,15H,10-11H2/t15-/m1/s1
InChI key:InChIKey=DFFGUPIVHPCCGK-OAHLLOKOSA-N
SMILES:C(CC1=CC(Cl)=CC=C1)(=O)N2[C@H](COC2=O)C3=CC=CC=C3
Synonyms:- (4S)-3-[2-(3-Chlorophenyl)acetyl]-4-phenyl-2-oxazolidinone
- 2-Oxazolidinone, 3-[2-(3-chlorophenyl)acetyl]-4-phenyl-, (4S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.