CAS 1332529-25-5

Pyrimidine, 5-(2-pyrrolidinyl)-, hydrochloride (1:2)

Description:

Pyrimidine, 5-(2-pyrrolidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. This compound features a pyrrolidine moiety, a five-membered saturated ring containing one nitrogen atom, which is attached to the pyrimidine ring at the 5-position. The hydrochloride designation indicates that the compound exists as a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of both the pyrimidine and pyrrolidine structures suggests potential biological activity, possibly influencing neurotransmitter systems or serving as a scaffold for drug development. As with many nitrogen-containing heterocycles, it may exhibit properties such as basicity and the ability to form hydrogen bonds, which are important for interactions with biological targets. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.

Formula: C₈H₁₁N₃·2ClH

InChI: InChI=1S/C8H11N3.2ClH/c1-2-8(11-3-1)7-4-9-6-10-5-7;;/h4-6,8,11H,1-3H2;2*1H

InChI key: InChIKey=QDBSSWJYOFRDNO-UHFFFAOYSA-N

SMILES: C1(CCCN1)C=2C=NC=NC2.Cl

Synonyms:

• Pyrimidine, 5-(2-pyrrolidinyl)-, hydrochloride (1:2)