CymitQuimica logo

CAS 1332529-27-7

:

1H-Pyrazolo[4,3-c]pyridine, 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4,5,6,7-tetrahydro-1-methyl-, hydrochloride (1:1)

Description:
1H-Pyrazolo[4,3-c]pyridine, 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4,5,6,7-tetrahydro-1-methyl-, hydrochloride (1:1) is a complex organic compound characterized by its unique bicyclic structure, which incorporates both pyrazole and pyridine moieties. This compound features a cyclopropyl group and an oxadiazole ring, contributing to its potential biological activity. The presence of the hydrochloride salt form indicates that it is a protonated species, which can enhance its solubility in aqueous environments, making it suitable for various applications, including pharmaceutical research. The tetrahydro structure suggests that it may exhibit a degree of flexibility, potentially influencing its interaction with biological targets. Additionally, the compound's molecular configuration may impart specific pharmacological properties, making it of interest in drug discovery and development. Overall, this substance exemplifies the intricate relationship between molecular structure and biological function, warranting further investigation into its potential therapeutic applications.
Formula:C12H15N5O.ClH
InChI:InChI=1S/C12H15N5O.ClH/c1-17-9-4-5-13-6-8(9)10(15-17)12-14-11(16-18-12)7-2-3-7;/h7,13H,2-6H2,1H3;1H
InChI key:InChIKey=SRKSLAGDXMXQKT-UHFFFAOYSA-N
SMILES:CN1N=C(C2=C1CCNC2)C3=NC(=NO3)C4CC4.Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.