CAS 1332529-29-9

5-Bromo-N,N-dimethyl-α-methylene-2-pyridinemethanamine

Description:

5-Bromo-N,N-dimethyl-α-methylene-2-pyridinemethanamine is a chemical compound characterized by its unique structure, which includes a pyridine ring and a bromine substituent. This compound features a methylene bridge connecting the pyridine nitrogen to a dimethylamino group, contributing to its basicity and potential reactivity. The presence of the bromine atom enhances its electrophilic properties, making it useful in various synthetic applications. Typically, compounds of this nature exhibit moderate solubility in polar solvents due to the presence of the nitrogen atom, which can engage in hydrogen bonding. Additionally, the dimethylamino group imparts basic characteristics, allowing for protonation under acidic conditions. This compound may be of interest in medicinal chemistry and organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Its reactivity and structural features suggest potential applications in the formation of more complex molecular architectures. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any associated risks.

Formula: C₉H₁₁BrN₂

InChI: InChI=1S/C9H11BrN2/c1-7(12(2)3)9-5-4-8(10)6-11-9/h4-6H,1H2,2-3H3

InChI key: InChIKey=VPEFVMHIGFXEJF-UHFFFAOYSA-N

SMILES: C(N(C)C)(=C)C1=CC=C(Br)C=N1

Synonyms:

• 5-Bromo-N,N-dimethyl-α-methylene-2-pyridinemethanamine
• 2-Pyridinemethanamine, 5-bromo-N,N-dimethyl-α-methylene-