CAS 1332529-35-7

4-Quinolinecarbonyl chloride, 6-methyl-2-(3-pyridinyl)-, hydrochloride (1:1)

Description:

4-Quinolinecarbonyl chloride, 6-methyl-2-(3-pyridinyl)-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a quinoline moiety and a pyridine ring. This substance typically appears as a solid and is known for its reactivity due to the presence of the carbonyl chloride functional group, which can participate in various chemical reactions, including acylation and nucleophilic attacks. The hydrochloride form indicates that it is a salt, which enhances its solubility in polar solvents, making it useful in various applications, including pharmaceuticals and organic synthesis. The compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of bioactive molecules. Its specific properties, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of other reagents. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula: C₁₆H₁₁ClN₂O·ClH

InChI: InChI=1S/C16H11ClN2O.ClH/c1-10-4-5-14-12(7-10)13(16(17)20)8-15(19-14)11-3-2-6-18-9-11;/h2-9H,1H3;1H

InChI key: InChIKey=HOAFPQCDZURVOZ-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C=3C=CC=NC3)C=CC(C)=C2.Cl

Synonyms:

• 4-Quinolinecarbonyl chloride, 6-methyl-2-(3-pyridinyl)-, hydrochloride (1:1)