CAS 1332529-47-1

Methanone, (1-methyl-1H-indol-2-yl)-1-piperazinyl-, hydrochloride (1:1)

Description:

Methanone, (1-methyl-1H-indol-2-yl)-1-piperazinyl-, hydrochloride (1:1), identified by the CAS number 1332529-47-1, is a chemical compound that features a piperazine moiety linked to an indole derivative. This compound typically exhibits characteristics associated with both indole and piperazine structures, which may include biological activity, particularly in the context of pharmacology. The presence of the hydrochloride salt form suggests enhanced solubility in water, making it suitable for various applications, including potential therapeutic uses. The indole structure is known for its role in many natural products and pharmaceuticals, while piperazine derivatives are often associated with psychoactive properties. The compound's specific interactions, stability, and reactivity would depend on its molecular configuration and the functional groups present. As with many such compounds, safety and handling precautions are essential, particularly in laboratory settings, due to potential toxicity or reactivity. Further studies would be necessary to elucidate its full range of properties and potential applications.

Formula: C₁₄H₁₇N₃O·ClH

InChI: InChI=1S/C14H17N3O.ClH/c1-16-12-5-3-2-4-11(12)10-13(16)14(18)17-8-6-15-7-9-17;/h2-5,10,15H,6-9H2,1H3;1H

InChI key: InChIKey=MLOYAHWCZJOCBQ-UHFFFAOYSA-N

SMILES: C(=O)(C=1N(C)C=2C(C1)=CC=CC2)N3CCNCC3.Cl

Synonyms:

• Methanone, (1-methyl-1H-indol-2-yl)-1-piperazinyl-, hydrochloride (1:1)