CAS 1332529-60-8

Cyclopropanamine, 1-(2-furanyl)-, hydrochloride (1:1)

Description:

Cyclopropanamine, 1-(2-furanyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a furanyl group. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The cyclopropanamine moiety contributes to its potential reactivity and biological activity, as cyclopropane derivatives are often involved in medicinal chemistry due to their ability to interact with biological targets. The furanyl group, derived from furan, adds aromatic characteristics and may influence the compound's electronic properties and stability. This compound's specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods. Overall, cyclopropanamine, 1-(2-furanyl)-, hydrochloride (1:1) represents a class of compounds that may exhibit interesting pharmacological properties, warranting further investigation in drug development and synthesis.

Formula: C₇H₉NO·ClH

InChI: InChI=1S/C7H9NO.ClH/c8-7(3-4-7)6-2-1-5-9-6;/h1-2,5H,3-4,8H2;1H

InChI key: InChIKey=FVUNBOONUXNMSG-UHFFFAOYSA-N

SMILES: NC1(CC1)C2=CC=CO2.Cl

Synonyms:

• Cyclopropanamine, 1-(2-furanyl)-, hydrochloride (1:1)