CAS 1332529-79-9

3-Pyridinemethanamine, 5-(trifluoromethyl)-, hydrochloride (1:2)

Description:

3-Pyridinemethanamine, 5-(trifluoromethyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a trifluoromethyl group (-CF3) at the 5-position of the pyridine enhances its lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceuticals. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for drug development due to its structural features. The trifluoromethyl group is known to impart unique electronic properties, potentially affecting the compound's reactivity and interaction with biological targets. Safety data should be consulted for handling and usage, as compounds with trifluoromethyl groups can exhibit toxicity or environmental concerns. Overall, this compound's characteristics make it of interest in both synthetic and medicinal chemistry contexts.

Formula: C₇H₇F₃N₂·2ClH

InChI: InChI=1S/C7H7F3N2.2ClH/c8-7(9,10)6-1-5(2-11)3-12-4-6;;/h1,3-4H,2,11H2;2*1H

InChI key: InChIKey=XRJFAOSMGPIFLC-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(CN)C=NC1.Cl

Synonyms:

• 3-Pyridinemethanamine, 5-(trifluoromethyl)-, hydrochloride (1:2)

C-(5-Trifluoromethyl-pyridin-3-yl)-methylaminedihydrochloride

CAS: 1332529-79-9

Versatile small molecule scaffold

Formula: C₇H₉Cl₂F₃N₂

Purity: Min. 95%

Molecular weight: 249.06 g/mol

Ref: 3D-HDC52979