CAS 1332530-04-7

Phenol, 4-[[[2-(1-piperidinylsulfonyl)ethyl]amino]methyl]-, ethanedioate (1:1)

Description:

Phenol, 4-[[[2-(1-piperidinylsulfonyl)ethyl]amino]methyl]-, ethanedioate (1:1), identified by CAS number 1332530-04-7, is a chemical compound characterized by its complex structure that includes a phenolic group and a piperidine moiety. This compound typically exhibits properties associated with both phenols and sulfonamides, which may contribute to its biological activity. The presence of the piperidine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The ethanedioate component indicates that it forms a salt or ester with oxalic acid, which may influence its solubility and stability in various environments. Generally, compounds of this nature may possess antimicrobial or anti-inflammatory properties, although specific biological activities would depend on further empirical studies. Additionally, the compound's solubility, melting point, and reactivity would be influenced by its functional groups and overall molecular structure, making it a candidate for various applications in pharmaceuticals and chemical research.

Formula: C₁₄H₂₂N₂O₃S·C₂H₂O₄

InChI: InChI=1S/C14H22N2O3S.C2H2O4/c17-14-6-4-13(5-7-14)12-15-8-11-20(18,19)16-9-2-1-3-10-16;3-1(4)2(5)6/h4-7,15,17H,1-3,8-12H2;(H,3,4)(H,5,6)

InChI key: InChIKey=KXCJOJHRTMRMHL-UHFFFAOYSA-N

SMILES: S(CCNCC1=CC=C(O)C=C1)(=O)(=O)N2CCCCC2.C(C(O)=O)(O)=O

Synonyms:

• Phenol, 4-[[[2-(1-piperidinylsulfonyl)ethyl]amino]methyl]-, ethanedioate (1:1)