CymitQuimica logo

CAS 1332530-28-5

:

2-Thiophenecarboxylic acid, 5-[(methylamino)methyl]-, hydrochloride (1:1)

Description:
2-Thiophenecarboxylic acid, 5-[(methylamino)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features a carboxylic acid functional group and a methylamino group, indicating its potential as an acid-base compound. The hydrochloride form suggests that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceuticals. The presence of the methylamino group may impart basic properties, allowing for interactions with biological systems. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of more complex molecules. Its specific properties, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is used. As with many chemical substances, safety data and handling precautions should be considered, especially in laboratory or industrial settings.
Formula:C7H9NO2S·ClH
InChI:InChI=1S/C7H9NO2S.ClH/c1-8-4-5-2-3-6(11-5)7(9)10;/h2-3,8H,4H2,1H3,(H,9,10);1H
InChI key:InChIKey=FEDZRZXMJAQOPA-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1SC(CNC)=CC1.Cl
Synonyms:
  • 2-Thiophenecarboxylic acid, 5-[(methylamino)methyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.