CAS 1332530-29-6

Cyclohexanemethanamine, 1-(5-chloro-2-thienyl)-, hydrochloride (1:1)

Description:

Cyclohexanemethanamine, 1-(5-chloro-2-thienyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclohexane ring and a thienyl group substituted with a chlorine atom. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various applications. The presence of the amine functional group suggests potential basicity and reactivity, making it suitable for various chemical reactions, including those involving nucleophilic substitution. The thienyl moiety may impart specific biological activities, potentially making this compound of interest in pharmaceutical research. Its hydrochloride form indicates that it can exist as a stable crystalline solid under appropriate conditions. As with many organic compounds, safety and handling precautions are essential, particularly due to the presence of chlorine, which can pose health risks. Overall, this compound's structural features and properties make it a subject of interest in both synthetic chemistry and medicinal chemistry.

Formula: C₁₁H₁₆ClNS·ClH

InChI: InChI=1S/C11H16ClNS.ClH/c12-10-5-4-9(14-10)11(8-13)6-2-1-3-7-11;/h4-5H,1-3,6-8,13H2;1H

InChI key: InChIKey=WTNRNVYFSNPYPA-UHFFFAOYSA-N

SMILES: C(N)C1(CCCCC1)C=2SC(Cl)=CC2.Cl

Synonyms:

• Cyclohexanemethanamine, 1-(5-chloro-2-thienyl)-, hydrochloride (1:1)