
CAS 1332530-32-1
:Benzenemethanamine, N-cyclopropyl-3-methyl-, hydrochloride (1:1)
Description:
Benzenemethanamine, N-cyclopropyl-3-methyl-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and a cyclopropyl substituent. This compound features a benzene ring attached to a methanamine structure, with a methyl group positioned at the third carbon of the benzene ring. The hydrochloride form indicates that the amine is protonated, enhancing its solubility in water and making it more stable in various environments. Typically, compounds of this nature may exhibit biological activity, potentially serving as intermediates in pharmaceutical synthesis or as active pharmaceutical ingredients. The presence of the cyclopropyl group can influence the compound's steric and electronic properties, which may affect its reactivity and interaction with biological targets. As with many amines, it may also participate in hydrogen bonding, impacting its physical properties such as boiling point and solubility. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C11H15N·ClH
InChI:InChI=1S/C11H15N.ClH/c1-9-3-2-4-10(7-9)8-12-11-5-6-11;/h2-4,7,11-12H,5-6,8H2,1H3;1H
InChI key:InChIKey=OFPUQUOTWBKYMK-UHFFFAOYSA-N
SMILES:N(CC1=CC(C)=CC=C1)C2CC2.Cl
Synonyms:- Benzenemethanamine, N-cyclopropyl-3-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.