CAS 1332530-34-3

Imidazo[2,1-b]-1,3,4-thiadiazole-6-methanamine, hydrochloride (1:2)

Description:

Imidazo[2,1-b]-1,3,4-thiadiazole-6-methanamine, hydrochloride (1:2) is a chemical compound characterized by its unique bicyclic structure that incorporates both imidazole and thiadiazole rings. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of the methanamine group contributes to its basicity and potential reactivity, making it of interest in various chemical and pharmaceutical applications. Its molecular structure suggests potential biological activity, which has led to investigations into its use in medicinal chemistry, particularly in the development of novel therapeutic agents. As with many nitrogen-containing heterocycles, it may exhibit properties such as antimicrobial or anti-inflammatory effects, although specific biological activities would require empirical studies. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper safety protocols are followed.

Formula: C₅H₆N₄S·2ClH

InChI: InChI=1S/C5H6N4S.2ClH/c6-1-4-2-9-5(8-4)10-3-7-9;;/h2-3H,1,6H2;2*1H

InChI key: InChIKey=MQRGCFVSVRACFZ-UHFFFAOYSA-N

SMILES: C(N)C=1N=C2N(C1)N=CS2.Cl

Synonyms:

• Imidazo[2,1-b]-1,3,4-thiadiazole-6-methanamine, hydrochloride (1:2)