CAS 1332530-35-4

4-Pyrimidinemethanamine, N,2-dimethyl-, hydrochloride (1:2)

Description:

4-Pyrimidinemethanamine, N,2-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. This compound features a methanamine group attached to the pyrimidine, along with two methyl groups on the nitrogen, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the hydrochloride indicates that it can form stable ionic interactions, which may influence its biological activity and pharmacokinetics. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for drug development, particularly in areas related to neurological or metabolic disorders. Its specific characteristics, including melting point, solubility, and reactivity, would depend on the conditions of use and the presence of other substances in a given formulation.

Formula: C₇H₁₁N₃·2ClH

InChI: InChI=1S/C7H11N3.2ClH/c1-6-9-4-3-7(10-6)5-8-2;;/h3-4,8H,5H2,1-2H3;2*1H

InChI key: InChIKey=XMGXVAKFYXGSSH-UHFFFAOYSA-N

SMILES: C(NC)C1=NC(C)=NC=C1.Cl

Synonyms:

• 4-Pyrimidinemethanamine, N,2-dimethyl-, hydrochloride (1:2)