
CAS 1332530-39-8
:4-Pyrimidinemethanamine, N-ethyl-2-(1-methylethyl)-, hydrochloride (1:2)
Description:
4-Pyrimidinemethanamine, N-ethyl-2-(1-methylethyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features an ethyl group and an isopropyl group attached to the amine, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the amine functional group suggests potential basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Its specific stereochemistry and functional groups may influence its biological activity, making it of interest in medicinal chemistry. Safety data and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further characterization would typically involve techniques such as NMR, IR spectroscopy, and mass spectrometry to confirm its structure and purity.
Formula:C10H17N3·2ClH
InChI:InChI=1S/C10H17N3.2ClH/c1-4-11-7-9-5-6-12-10(13-9)8(2)3;;/h5-6,8,11H,4,7H2,1-3H3;2*1H
InChI key:InChIKey=CDVFBCUQVWSFPX-UHFFFAOYSA-N
SMILES:C(NCC)C1=NC(C(C)C)=NC=C1.Cl
Synonyms:- 4-Pyrimidinemethanamine, N-ethyl-2-(1-methylethyl)-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.