CAS 1332530-43-4

1H-Indole-2-carboxylic acid, 3-(2-aminoethyl)-5,7-dichloro-, hydrochloride (1:1)

Description:

1H-Indole-2-carboxylic acid, 3-(2-aminoethyl)-5,7-dichloro-, hydrochloride (1:1) is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features a carboxylic acid functional group and two chlorine substituents at the 5 and 7 positions of the indole ring, contributing to its reactivity and potential biological activity. The presence of the aminoethyl side chain at the 3 position enhances its solubility and may influence its interaction with biological targets. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications in pharmaceutical research. The compound's unique structure suggests potential uses in medicinal chemistry, particularly in the development of therapeutic agents targeting specific biological pathways. Its CAS number, 1332530-43-4, allows for precise identification in chemical databases and literature.

Formula: C₁₁H₁₀Cl₂N₂O₂·ClH

InChI: InChI=1S/C11H10Cl2N2O2.ClH/c12-5-3-7-6(1-2-14)10(11(16)17)15-9(7)8(13)4-5;/h3-4,15H,1-2,14H2,(H,16,17);1H

InChI key: InChIKey=IALUYXFAGLZFML-UHFFFAOYSA-N

SMILES: C(CN)C=1C=2C(NC1C(O)=O)=C(Cl)C=C(Cl)C2.Cl

Synonyms:

• 1H-Indole-2-carboxylic acid, 3-(2-aminoethyl)-5,7-dichloro-, hydrochloride (1:1)