CAS 1332530-46-7

2-Thiazolemethanamine, 4-(3-chlorophenyl)-, hydrochloride (1:2)

Description:

2-Thiazolemethanamine, 4-(3-chlorophenyl)-, hydrochloride (1:2) is a chemical compound characterized by its thiazole and amine functional groups, which contribute to its potential biological activity. The presence of the 3-chlorophenyl group suggests that it may exhibit specific interactions with biological targets, possibly influencing its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. The compound's structure indicates it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Its CAS number, 1332530-46-7, allows for precise identification in chemical databases. While specific data on its toxicity and safety profile may not be widely available, compounds with similar structures often require careful handling due to potential biological activity. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of designing new therapeutic agents.

Formula: C₁₀H₉ClN₂S·2ClH

InChI: InChI=1S/C10H9ClN2S.2ClH/c11-8-3-1-2-7(4-8)9-6-14-10(5-12)13-9;;/h1-4,6H,5,12H2;2*1H

InChI key: InChIKey=PUINFGSHYHFVQF-UHFFFAOYSA-N

SMILES: C(N)C1=NC(=CS1)C2=CC(Cl)=CC=C2.Cl

Synonyms:

• 2-Thiazolemethanamine, 4-(3-chlorophenyl)-, hydrochloride (1:2)