CAS 1332530-76-3

4-Quinolinecarbonyl chloride, 7-chloro-8-methyl-2-(4-pyridinyl)-, hydrochloride (1:1)

Description:

4-Quinolinecarbonyl chloride, 7-chloro-8-methyl-2-(4-pyridinyl)-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a quinoline moiety and a pyridine ring. This substance typically appears as a solid and is soluble in polar organic solvents. The presence of the carbonyl chloride functional group suggests it may be reactive, particularly with nucleophiles, making it useful in various synthetic applications. The hydrochloride form indicates that it is a salt, which can enhance its stability and solubility in aqueous solutions. This compound may exhibit biological activity, potentially serving as a pharmacophore in medicinal chemistry, particularly in the development of antimalarial or antimicrobial agents. Its specific properties, such as melting point, boiling point, and spectral characteristics, would depend on the purity and specific conditions under which it is handled. As with many chlorinated compounds, appropriate safety measures should be taken due to potential toxicity and reactivity.

Formula: C₁₆H₁₀Cl₂N₂O·ClH

InChI: InChI=1S/C16H10Cl2N2O.ClH/c1-9-13(17)3-2-11-12(16(18)21)8-14(20-15(9)11)10-4-6-19-7-5-10;/h2-8H,1H3;1H

InChI key: InChIKey=UFYIFYSNQNTUDC-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C=3C=CN=CC3)C(C)=C(Cl)C=C2.Cl

Synonyms:

• 4-Quinolinecarbonyl chloride, 7-chloro-8-methyl-2-(4-pyridinyl)-, hydrochloride (1:1)