CymitQuimica logo

CAS 1332530-87-6

:

Imidazo[1,2-a]pyrimidine-2-acetic acid, α-ethyl-, hydrochloride (1:1)

Description:
Imidazo[1,2-a]pyrimidine-2-acetic acid, α-ethyl-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which combines elements of imidazole and pyrimidine rings. This compound typically exhibits properties such as solubility in water due to the presence of the hydrochloride salt form, which enhances its stability and bioavailability. The α-ethyl substitution on the acetic acid moiety contributes to its potential pharmacological activity, making it of interest in medicinal chemistry. The compound may display various biological activities, including anti-inflammatory or antimicrobial properties, although specific activities can vary based on structural modifications and the presence of functional groups. Its molecular interactions are influenced by the nitrogen atoms in the rings, which can participate in hydrogen bonding and coordination with biological targets. As with many pharmaceuticals, safety and efficacy profiles are essential for its application, necessitating thorough research and testing in preclinical and clinical settings. Overall, this compound represents a class of heterocyclic compounds with potential therapeutic implications.
Formula:C10H11N3O2·ClH
InChI:InChI=1S/C10H11N3O2.ClH/c1-2-7(9(14)15)8-6-13-5-3-4-11-10(13)12-8;/h3-7H,2H2,1H3,(H,14,15);1H
InChI key:InChIKey=WNZHUMCMFNYBFN-UHFFFAOYSA-N
SMILES:C(C(O)=O)(CC)C1=CN2C(=N1)N=CC=C2.Cl
Synonyms:
  • Imidazo[1,2-a]pyrimidine-2-acetic acid, α-ethyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.