
CAS 1332530-88-7
:Piperidine, 3-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)-, hydrochloride (1:2)
Description:
Piperidine, 3-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. The presence of the 3-cyclopropyl-1H-1,2,4-triazol-5-yl substituent indicates that it has a triazole ring, which is a five-membered ring containing three nitrogen atoms, contributing to its potential biological activity. The hydrochloride form suggests that the compound is a salt, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceuticals. This compound may exhibit properties such as antimicrobial, antifungal, or anti-inflammatory activities, typical of triazole derivatives. Its structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. As with many nitrogen-containing heterocycles, it may also participate in hydrogen bonding and other interactions that influence its reactivity and stability. Overall, this compound represents a unique combination of piperidine and triazole functionalities, which may be explored for therapeutic uses.
Formula:C10H16N4·2ClH
InChI:InChI=1S/C10H16N4.2ClH/c1-2-8(6-11-5-1)10-12-9(13-14-10)7-3-4-7;;/h7-8,11H,1-6H2,(H,12,13,14);2*1H
InChI key:InChIKey=HHOJPZROXSLQEO-UHFFFAOYSA-N
SMILES:C=1(NC(=NN1)C2CCCNC2)C3CC3.Cl
Synonyms:- Piperidine, 3-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.