
CAS 1332530-94-5
:Glycine, N-(3,4,5,6-tetrahydro-2H-azepin-7-yl)-, methyl ester, hydrochloride (1:1)
Description:
Glycine, N-(3,4,5,6-tetrahydro-2H-azepin-7-yl)-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a glycine moiety linked to a tetrahydroazepine derivative. This compound is typically a white to off-white solid, soluble in water and polar organic solvents due to the presence of both the amino acid and the hydrochloride salt. The tetrahydroazepine ring contributes to its potential biological activity, possibly influencing neurochemical pathways or serving as a scaffold for drug development. As a hydrochloride salt, it exhibits enhanced stability and solubility, making it suitable for pharmaceutical applications. The compound's molecular interactions may involve hydrogen bonding and ionic interactions, which are critical for its biological function. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies may be necessary to fully elucidate its pharmacological properties and potential therapeutic uses.
Formula:C9H16N2O2·ClH
InChI:InChI=1S/C9H16N2O2.ClH/c1-13-9(12)7-11-8-5-3-2-4-6-10-8;/h2-7H2,1H3,(H,10,11);1H
InChI key:InChIKey=OPHJMVJDCRBXFL-UHFFFAOYSA-N
SMILES:N(CC(OC)=O)C=1CCCCCN1.Cl
Synonyms:- Glycine, N-(3,4,5,6-tetrahydro-2H-azepin-7-yl)-, methyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.