CAS 1332531-06-2

1-Propanol, 3-[[(5-methyl-2-thiazolyl)methyl]amino]-, hydrochloride (1:2)

Description:

1-Propanol, 3-[[[5-methyl-2-thiazolyl)methyl]amino]-, hydrochloride (1:2) is a chemical compound characterized by its specific structural features, including a propanol backbone and a thiazole ring. The presence of the thiazole moiety suggests potential biological activity, as thiazoles are often found in pharmaceuticals and agrochemicals. The hydrochloride form indicates that the compound is a salt, which typically enhances its solubility in water, making it more suitable for various applications, including biological assays. The compound's molecular structure includes functional groups that may participate in hydrogen bonding, influencing its reactivity and interaction with other molecules. Additionally, the presence of the amino group suggests potential for further derivatization or interaction with biological targets. Overall, this compound may exhibit interesting pharmacological properties, although specific data on its biological activity, toxicity, and applications would require further investigation and research.

Formula: C₈H₁₄N₂OS·2ClH

InChI: InChI=1S/C8H14N2OS.2ClH/c1-7-5-10-8(12-7)6-9-3-2-4-11;;/h5,9,11H,2-4,6H2,1H3;2*1H

InChI key: InChIKey=HLBJEDLVFSZNSK-UHFFFAOYSA-N

SMILES: C(NCCCO)C=1SC(C)=CN1.Cl

Synonyms:

• 1-Propanol, 3-[[(5-methyl-2-thiazolyl)methyl]amino]-, hydrochloride (1:2)