CymitQuimica logo

CAS 1332531-13-1

:

1-Oxa-9-azaspiro[5.5]undecan-4-amine, 9-(phenylmethyl)-, hydrochloride (1:2)

Description:
1-Oxa-9-azaspiro[5.5]undecan-4-amine, 9-(phenylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and oxygen heteroatoms. The presence of the spiro configuration contributes to its three-dimensional shape, potentially influencing its biological activity and interaction with receptors. The compound features a phenylmethyl group, which may enhance lipophilicity and facilitate membrane permeability. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The compound's amine functional group suggests potential basicity, allowing it to participate in various chemical reactions, including protonation and nucleophilic attacks. Its specific properties, such as melting point, solubility, and stability, would depend on the conditions of use and formulation. Overall, this compound may have implications in medicinal chemistry, particularly in the development of therapeutic agents targeting specific biological pathways.
Formula:C16H24N2O·2ClH
InChI:InChI=1S/C16H24N2O.2ClH/c17-15-6-11-19-16(12-15)7-9-18(10-8-16)13-14-4-2-1-3-5-14;;/h1-5,15H,6-13,17H2;2*1H
InChI key:InChIKey=NMTGMNSYUWSLQJ-UHFFFAOYSA-N
SMILES:NC1CC2(CCN(CC3=CC=CC=C3)CC2)OCC1.Cl
Synonyms:
  • 1-Oxa-9-azaspiro[5.5]undecan-4-amine, 9-(phenylmethyl)-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.