
CAS 1332531-14-2
:Benzamide, N-cyclopropyl-4-(4-piperidinylmethoxy)-, hydrochloride (1:1)
Description:
Benzamide, N-cyclopropyl-4-(4-piperidinylmethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its benzamide structure, which includes a cyclopropyl group and a piperidinylmethoxy substituent. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and methanol, owing to the presence of the hydrochloride salt form. The piperidine moiety contributes to its potential biological activity, often associated with interactions at neurotransmitter receptors. The presence of the cyclopropyl group may influence the compound's pharmacokinetics and receptor binding properties. As with many benzamide derivatives, this compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in therapeutic contexts.
Formula:C16H22N2O2·ClH
InChI:InChI=1S/C16H22N2O2.ClH/c19-16(18-14-3-4-14)13-1-5-15(6-2-13)20-11-12-7-9-17-10-8-12;/h1-2,5-6,12,14,17H,3-4,7-11H2,(H,18,19);1H
InChI key:InChIKey=FJTRDDBVVKCYIV-UHFFFAOYSA-N
SMILES:N(C(=O)C1=CC=C(OCC2CCNCC2)C=C1)C3CC3.Cl
Synonyms:- Benzamide, N-cyclopropyl-4-(4-piperidinylmethoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.