CAS 1332531-20-0

4-Quinolinecarbonyl chloride, 6-ethyl-2-(2-pyridinyl)-, hydrochloride (1:1)

Description:

4-Quinolinecarbonyl chloride, 6-ethyl-2-(2-pyridinyl)-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a quinoline moiety and a pyridine ring. This compound typically appears as a solid and is known for its reactivity due to the presence of the carbonyl chloride functional group, which can participate in nucleophilic substitution reactions. The hydrochloride form indicates that it is a salt, enhancing its solubility in polar solvents, particularly water. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its synthesis often involves multi-step organic reactions, and it may be used as an intermediate in the preparation of other chemical entities. Safety precautions should be observed when handling this substance, as carbonyl chlorides can be corrosive and toxic. Proper storage conditions are essential to maintain its stability and prevent degradation. Overall, this compound represents a valuable entity in the field of organic synthesis and pharmaceutical research.

Formula: C₁₇H₁₃ClN₂O·ClH

InChI: InChI=1S/C17H13ClN2O.ClH/c1-2-11-6-7-14-12(9-11)13(17(18)21)10-16(20-14)15-5-3-4-8-19-15;/h3-10H,2H2,1H3;1H

InChI key: InChIKey=PDIYMLWLWCVGHC-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=CC=N3)C=CC(CC)=C2.Cl

Synonyms:

• 4-Quinolinecarbonyl chloride, 6-ethyl-2-(2-pyridinyl)-, hydrochloride (1:1)