CAS 1332531-22-2

4-Thiazoleethanamine, 2-[4-(trifluoromethyl)phenyl]-, hydrochloride (1:2)

Description:

4-Thiazoleethanamine, 2-[4-(trifluoromethyl)phenyl]-, hydrochloride (1:2) is a chemical compound characterized by its thiazole and phenyl functional groups, specifically featuring a trifluoromethyl substituent on the phenyl ring. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in pharmaceutical and chemical research. The presence of the thiazole ring contributes to its potential biological activity, as thiazoles are known for their roles in medicinal chemistry. The trifluoromethyl group is notable for its influence on the compound's electronic properties, potentially enhancing lipophilicity and metabolic stability. As a hydrochloride salt, it is likely to exhibit improved stability and handling characteristics compared to its free base form. Overall, this compound's unique structural features suggest potential utility in drug development and other chemical applications, although specific biological activities and interactions would require further investigation.

Formula: C₁₂H₁₁F₃N₂S·2ClH

InChI: InChI=1S/C12H11F3N2S.2ClH/c13-12(14,15)9-3-1-8(2-4-9)11-17-10(5-6-16)7-18-11;;/h1-4,7H,5-6,16H2;2*1H

InChI key: InChIKey=FBKKAURIQIFUCZ-UHFFFAOYSA-N

SMILES: C(CN)C=1N=C(C2=CC=C(C(F)(F)F)C=C2)SC1.Cl

Synonyms:

• 4-Thiazoleethanamine, 2-[4-(trifluoromethyl)phenyl]-, hydrochloride (1:2)