
CAS 1332531-42-6
:1H-Pyrazol-3-amine, 4-bromo-1-[(2,4-dichlorophenyl)methyl]-, hydrochloride (1:1)
Description:
1H-Pyrazol-3-amine, 4-bromo-1-[(2,4-dichlorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a bromo substituent at the 4-position and a dichlorophenyl group at the 1-position contributes to its unique chemical properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in pharmaceutical applications. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, possibly influencing pathways related to inflammation or cancer. The presence of halogen atoms (bromine and chlorine) often enhances lipophilicity and can affect the compound's reactivity and binding affinity. Overall, this compound's characteristics make it a subject of interest for further research in drug development and chemical synthesis.
Formula:C10H8BrCl2N3·ClH
InChI:InChI=1S/C10H8BrCl2N3.ClH/c11-8-5-16(15-10(8)14)4-6-1-2-7(12)3-9(6)13;/h1-3,5H,4H2,(H2,14,15);1H
InChI key:InChIKey=CFAYKINCJQFJOM-UHFFFAOYSA-N
SMILES:C(C1=C(Cl)C=C(Cl)C=C1)N2C=C(Br)C(N)=N2.Cl
Synonyms:- 1H-Pyrazol-3-amine, 4-bromo-1-[(2,4-dichlorophenyl)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.